C12H14Cl2O6 — CID 124897409
(2S,3S,4R,5R,6S)-2-(2,4-dichlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 124897409) has the molecular formula C12H14Cl2O6 and a molecular weight of 325.14 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-(2,4-dichlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6S)-2-(2,4-dichlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 124897409 |
| Molecular Formula | C12H14Cl2O6 |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-(2,4-dichlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@@H](Oc2ccc(Cl)cc2Cl)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H14Cl2O6/c13-5-1-2-7(6(14)3-5)19-12-11(18)10(17)9(16)8(4-15)20-12/h1-3,8-12,15-18H,4H2/t8-,9-,10+,11-,12+/m0/s1 |
| InChIKey | FMLFENLCSTYAST-HHHUOAJASA-N |
| XLogP | 0.17 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |