C12H15ClO6 — CID 7074542
(2S,3S,4R,5S,6S)-2-(3-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 7074542) has the molecular formula C12H15ClO6 and a molecular weight of 290.70 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-2-(3-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6S)-2-(3-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 7074542 |
| Molecular Formula | C12H15ClO6 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-(3-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@@H](Oc2cccc(Cl)c2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15ClO6/c13-6-2-1-3-7(4-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12+/m0/s1 |
| InChIKey | YLHUCWGBYLKMNO-MTVMDMGHSA-N |
| XLogP | -0.48 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |