C21H21ClO9 — CID 52918131
1-(3-chlorophenyl)-3-[2-hydroxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propane-1,3-dione (PubChem CID 52918131) has the molecular formula C21H21ClO9 and a molecular weight of 452.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-hydroxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propane-1,3-dione.
| Compound Name | 1-(3-chlorophenyl)-3-[2-hydroxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 52918131 |
| Molecular Formula | C21H21ClO9 |
| Molecular Weight | 452.84 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-hydroxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccc(OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21ClO9/c22-11-3-1-2-10(6-11)14(24)8-16(26)13-5-4-12(7-15(13)25)30-21-20(29)19(28)18(27)17(9-23)31-21/h1-7,17-21,23,25,27-29H,8-9H2/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | UIBCQLRQQMVVNO-AWGDKMGJSA-N |
| XLogP | 0.68 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.84 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|