C29H29ClO13 — CID 52916637
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[3-(3-chlorophenyl)-3-oxopropanoyl]-3-hydroxyphenoxy]oxan-2-yl]methyl acetate (PubChem CID 52916637) has the molecular formula C29H29ClO13 and a molecular weight of 620.99 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[3-(3-chlorophenyl)-3-oxopropanoyl]-3-hydroxyphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[3-(3-chlorophenyl)-3-oxopropanoyl]-3-hydroxyphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 52916637 |
| Molecular Formula | C29H29ClO13 |
| Molecular Weight | 620.99 g/mol |
| Exact Mass | 620.13 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[3-(3-chlorophenyl)-3-oxopropanoyl]-3-hydroxyphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(C(=O)CC(=O)c3cccc(Cl)c3)c(O)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H29ClO13/c1-14(31)38-13-25-26(39-15(2)32)27(40-16(3)33)28(41-17(4)34)29(43-25)42-20-8-9-21(23(36)11-20)24(37)12-22(35)18-6-5-7-19(30)10-18/h5-11,25-29,36H,12-13H2,1-4H3/t25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | GORBVQUPLWDBMK-XYPQWYOHSA-N |
| XLogP | 2.96 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.99 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|