C28H30O12 — CID 98393012
[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[3-hydroxy-4-(2-phenylacetyl)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 98393012) has the molecular formula C28H30O12 and a molecular weight of 558.54 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[3-hydroxy-4-(2-phenylacetyl)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[3-hydroxy-4-(2-phenylacetyl)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98393012 |
| Molecular Formula | C28H30O12 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[3-hydroxy-4-(2-phenylacetyl)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](Oc2ccc(C(=O)Cc3ccccc3)c(O)c2)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H30O12/c1-15(29)35-14-24-25(36-16(2)30)26(37-17(3)31)27(38-18(4)32)28(40-24)39-20-10-11-21(23(34)13-20)22(33)12-19-8-6-5-7-9-19/h5-11,13,24-28,34H,12,14H2,1-4H3/t24-,25+,26+,27+,28-/m0/s1 |
| InChIKey | NNWAGEQDNUVUNB-PKLSKMGNSA-N |
| XLogP | 2.28 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|