C27H29NO12 — CID 135615506
[3,4,5-triacetyloxy-6-[3-hydroxy-4-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 135615506) has the molecular formula C27H29NO12 and a molecular weight of 559.52 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[3-hydroxy-4-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[3-hydroxy-4-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135615506 |
| Molecular Formula | C27H29NO12 |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[3-hydroxy-4-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc(/C(=N/O)c3ccccc3)c(O)c2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C27H29NO12/c1-14(29)35-13-22-24(36-15(2)30)25(37-16(3)31)26(38-17(4)32)27(40-22)39-19-10-11-20(21(33)12-19)23(28-34)18-8-6-5-7-9-18/h5-12,22,24-27,33-34H,13H2,1-4H3/b28-23+ |
| InChIKey | LGGWIFCVDQIBES-WEMUOSSPSA-N |
| XLogP | 2.08 |
| TPSA | 176.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|