C28H29ClO12 — CID 124896841
[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-[2-(4-chlorophenyl)acetyl]-3-hydroxyphenoxy]oxan-2-yl]methyl acetate (PubChem CID 124896841) has the molecular formula C28H29ClO12 and a molecular weight of 592.98 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-[2-(4-chlorophenyl)acetyl]-3-hydroxyphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-[2-(4-chlorophenyl)acetyl]-3-hydroxyphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124896841 |
| Molecular Formula | C28H29ClO12 |
| Molecular Weight | 592.98 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-[2-(4-chlorophenyl)acetyl]-3-hydroxyphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](Oc2ccc(C(=O)Cc3ccc(Cl)cc3)c(O)c2)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H29ClO12/c1-14(30)36-13-24-25(37-15(2)31)26(38-16(3)32)27(39-17(4)33)28(41-24)40-20-9-10-21(23(35)12-20)22(34)11-18-5-7-19(29)8-6-18/h5-10,12,24-28,35H,11,13H2,1-4H3/t24-,25-,26+,27-,28-/m0/s1 |
| InChIKey | JWTWVAVUQMMSIC-KLMIGJKJSA-N |
| XLogP | 2.93 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|