C14H20O6 — CID 2844791
2-(3,4-dimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 2844791) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-(3,4-dimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 2844791 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1C |
| InChI | InChI=1S/C14H20O6/c1-7-3-4-9(5-8(7)2)19-14-13(18)12(17)11(16)10(6-15)20-14/h3-5,10-18H,6H2,1-2H3 |
| InChIKey | QUNVURUBSSMPMA-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |