C14H20O8 — CID 11695369
(3R,4S,5S,6R)-2-(3,4-dimethoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11695369) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-(3,4-dimethoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-(3,4-dimethoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11695369 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (3R,4S,5S,6R)-2-(3,4-dimethoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1ccc(OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1OC |
| InChI | InChI=1S/C14H20O8/c1-19-8-4-3-7(5-9(8)20-2)21-14-13(18)12(17)11(16)10(6-15)22-14/h3-5,10-18H,6H2,1-2H3/t10-,11-,12+,13-,14?/m1/s1 |
| InChIKey | ZDLZDPFUIWTENT-RQICVUQASA-N |
| XLogP | -1.12 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |