C12H16ClNO6 — CID 70377956
(2S,3R,4S,5S,6R)-2-(4-amino-2-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 70377956) has the molecular formula C12H16ClNO6 and a molecular weight of 305.71 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(4-amino-2-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(4-amino-2-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70377956 |
| Molecular Formula | C12H16ClNO6 |
| Molecular Weight | 305.71 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(4-amino-2-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO6/c13-6-3-5(14)1-2-7(6)19-12-11(18)10(17)9(16)8(4-15)20-12/h1-3,8-12,15-18H,4,14H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | SBOKKEKJLHNKLM-RMPHRYRLSA-N |
| XLogP | -0.90 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.71 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|