C23H25F3N2O8 — CID 57413591
1-N,3-N-dimethyl-5-[3-(trifluoromethyl)-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzene-1,3-dicarboxamide (PubChem CID 57413591) has the molecular formula C23H25F3N2O8 and a molecular weight of 514.45 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-5-[3-(trifluoromethyl)-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-dimethyl-5-[3-(trifluoromethyl)-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 57413591 |
| Molecular Formula | C23H25F3N2O8 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 1-N,3-N-dimethyl-5-[3-(trifluoromethyl)-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzene-1,3-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC)cc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H25F3N2O8/c1-27-20(33)12-5-11(6-13(7-12)21(34)28-2)10-3-4-15(14(8-10)23(24,25)26)35-22-19(32)18(31)17(30)16(9-29)36-22/h3-8,16-19,22,29-32H,9H2,1-2H3,(H,27,33)(H,28,34)/t16-,17-,18+,19+,22+/m1/s1 |
| InChIKey | ULLSFLLJXVBTBT-FNIAAEIWSA-N |
| XLogP | 0.27 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |