C23H27ClN2O7 — CID 130409092
5-[3-chloro-4-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide (PubChem CID 130409092) has the molecular formula C23H27ClN2O7 and a molecular weight of 478.93 g/mol. Its IUPAC name is 5-[3-chloro-4-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide.
| Compound Name | 5-[3-chloro-4-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 130409092 |
| Molecular Formula | C23H27ClN2O7 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 5-[3-chloro-4-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC)cc(-c2ccc(C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H27ClN2O7/c1-25-22(31)14-5-13(6-15(7-14)23(32)26-2)11-3-4-12(16(24)8-11)9-17-19(28)21(30)20(29)18(10-27)33-17/h3-8,17-21,27-30H,9-10H2,1-2H3,(H,25,31)(H,26,32)/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | VYRMXRPSUXCIFW-PFAUGDHASA-N |
| XLogP | 0.11 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |