C22H24O10 — CID 46838770
dimethyl 5-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzene-1,3-dicarboxylate (PubChem CID 46838770) has the molecular formula C22H24O10 and a molecular weight of 448.42 g/mol. Its IUPAC name is dimethyl 5-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 46838770 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | dimethyl 5-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc2)c1 |
| InChI | InChI=1S/C22H24O10/c1-29-20(27)13-7-12(8-14(9-13)21(28)30-2)11-3-5-15(6-4-11)31-22-19(26)18(25)17(24)16(10-23)32-22/h3-9,16-19,22-26H,10H2,1-2H3/t16-,17-,18+,19+,22+/m1/s1 |
| InChIKey | AJLVSCOTDPQPFW-FNIAAEIWSA-N |
| XLogP | 0.11 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |