C23H26O8 — CID 71467365
methyl 4-[3-cyclopropyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate (PubChem CID 71467365) has the molecular formula C23H26O8 and a molecular weight of 430.45 g/mol. Its IUPAC name is methyl 4-[3-cyclopropyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate.
| Compound Name | methyl 4-[3-cyclopropyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 71467365 |
| Molecular Formula | C23H26O8 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | methyl 4-[3-cyclopropyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c(C3CC3)c2)cc1 |
| InChI | InChI=1S/C23H26O8/c1-29-22(28)14-6-2-12(3-7-14)15-8-9-17(16(10-15)13-4-5-13)30-23-21(27)20(26)19(25)18(11-24)31-23/h2-3,6-10,13,18-21,23-27H,4-5,11H2,1H3/t18-,19-,20+,21+,23+/m1/s1 |
| InChIKey | OYHQWQVXPSMDJH-RBRWEJTLSA-N |
| XLogP | 1.20 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |