C18H24O8 — CID 163019498
methyl 4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-(3-methylbut-2-enoxy)benzoate (PubChem CID 163019498) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is methyl 4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-(3-methylbut-2-enoxy)benzoate.
| Compound Name | methyl 4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-(3-methylbut-2-enoxy)benzoate |
|---|---|
| PubChem CID | 163019498 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | methyl 4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-(3-methylbut-2-enoxy)benzoate |
| SMILES | COC(=O)c1ccc(O[C@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(OCC=C(C)C)c1 |
| InChI | InChI=1S/C18H24O8/c1-10(2)6-7-24-13-8-11(17(22)23-3)4-5-12(13)25-18-16(21)15(20)14(9-19)26-18/h4-6,8,14-16,18-21H,7,9H2,1-3H3/t14-,15-,16-,18+/m1/s1 |
| InChIKey | LTKOEKFHHKOTHT-KONPQCLYSA-N |
| XLogP | 0.64 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|