C19H19ClO8 — CID 53251475
4-[3-chloro-5-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoic acid (PubChem CID 53251475) has the molecular formula C19H19ClO8 and a molecular weight of 410.81 g/mol. Its IUPAC name is 4-[3-chloro-5-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoic acid.
| Compound Name | 4-[3-chloro-5-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 53251475 |
| Molecular Formula | C19H19ClO8 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-[3-chloro-5-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(Cl)cc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c2)cc1 |
| InChI | InChI=1S/C19H19ClO8/c20-12-5-11(9-1-3-10(4-2-9)18(25)26)6-13(7-12)27-19-17(24)16(23)15(22)14(8-21)28-19/h1-7,14-17,19,21-24H,8H2,(H,25,26)/t14-,15-,16+,17+,19+/m1/s1 |
| InChIKey | JANVLUKLTNUSLN-GJGATLCTSA-N |
| XLogP | 0.88 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |