C12H13Br3O6 — CID 162367328
(2S,3R,4R,5S,6R)-2-(hydroxymethyl)-6-(2,4,6-tribromophenoxy)oxane-3,4,5-triol (PubChem CID 162367328) has the molecular formula C12H13Br3O6 and a molecular weight of 492.94 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-(hydroxymethyl)-6-(2,4,6-tribromophenoxy)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-(hydroxymethyl)-6-(2,4,6-tribromophenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162367328 |
| Molecular Formula | C12H13Br3O6 |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 489.83 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-(hydroxymethyl)-6-(2,4,6-tribromophenoxy)oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@H](Oc2c(Br)cc(Br)cc2Br)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H13Br3O6/c13-4-1-5(14)11(6(15)2-4)21-12-10(19)9(18)8(17)7(3-16)20-12/h1-2,7-10,12,16-19H,3H2/t7-,8-,9+,10-,12+/m0/s1 |
| InChIKey | OLINLHROZJEXTO-GOVZDWNOSA-N |
| XLogP | 1.15 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |