C13H15Cl2NO8 — CID 10000059
(2R,3R,4S,5S,6R)-2-[2-(dichloromethyl)-4-nitrophenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10000059) has the molecular formula C13H15Cl2NO8 and a molecular weight of 384.17 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[2-(dichloromethyl)-4-nitrophenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[2-(dichloromethyl)-4-nitrophenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10000059 |
| Molecular Formula | C13H15Cl2NO8 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[2-(dichloromethyl)-4-nitrophenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(C(Cl)Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO8/c14-12(15)6-3-5(16(21)22)1-2-7(6)23-13-11(20)10(19)9(18)8(4-17)24-13/h1-3,8-13,17-20H,4H2/t8-,9-,10+,11-,13+/m1/s1 |
| InChIKey | RLBCAQXSTQCJGW-HMUNZLOLSA-N |
| XLogP | 0.25 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|