C21H23ClN2O8 — CID 85471212
(2R,3S,4S,5S,6R)-2-[2-chloro-4-(5-nitro-2,3-dihydroindol-1-yl)phenoxy]-6-[(1S)-1-hydroxyethyl]oxane-3,4,5-triol (PubChem CID 85471212) has the molecular formula C21H23ClN2O8 and a molecular weight of 466.87 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[2-chloro-4-(5-nitro-2,3-dihydroindol-1-yl)phenoxy]-6-[(1S)-1-hydroxyethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[2-chloro-4-(5-nitro-2,3-dihydroindol-1-yl)phenoxy]-6-[(1S)-1-hydroxyethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 85471212 |
| Molecular Formula | C21H23ClN2O8 |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[2-chloro-4-(5-nitro-2,3-dihydroindol-1-yl)phenoxy]-6-[(1S)-1-hydroxyethyl]oxane-3,4,5-triol |
| SMILES | C[C@H](O)[C@H]1O[C@H](Oc2ccc(N3CCc4cc([N+](=O)[O-])ccc43)cc2Cl)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H23ClN2O8/c1-10(25)20-18(27)17(26)19(28)21(32-20)31-16-5-3-12(9-14(16)22)23-7-6-11-8-13(24(29)30)2-4-15(11)23/h2-5,8-10,17-21,25-28H,6-7H2,1H3/t10-,17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | JENNKBXOOFPSDX-PLPLGYGLSA-N |
| XLogP | 1.51 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|