C20H21NO14 — CID 164586451
4-nitro-2-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxycarbonyloxan-2-yl]oxybenzoic acid (PubChem CID 164586451) has the molecular formula C20H21NO14 and a molecular weight of 499.38 g/mol. Its IUPAC name is 4-nitro-2-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxycarbonyloxan-2-yl]oxybenzoic acid.
| Compound Name | 4-nitro-2-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxycarbonyloxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 164586451 |
| Molecular Formula | C20H21NO14 |
| Molecular Weight | 499.38 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 4-nitro-2-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxycarbonyloxan-2-yl]oxybenzoic acid |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2cc([N+](=O)[O-])ccc2C(=O)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H21NO14/c1-8(22)31-14-15(32-9(2)23)17(33-10(3)24)20(35-16(14)19(27)30-4)34-13-7-11(21(28)29)5-6-12(13)18(25)26/h5-7,14-17,20H,1-4H3,(H,25,26)/t14-,15-,16-,17+,20+/m0/s1 |
| InChIKey | HXMAWNUOOUFWDI-RXBWTVHKSA-N |
| XLogP | 0.36 |
| TPSA | 204.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|