C22H29NO10 — CID 167628409
methyl (2S,3S,4S,5R,6S)-5-acetyloxy-3,4-dimethyl-6-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-nitrophenoxy]oxane-2-carboxylate (PubChem CID 167628409) has the molecular formula C22H29NO10 and a molecular weight of 467.47 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-5-acetyloxy-3,4-dimethyl-6-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-nitrophenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-5-acetyloxy-3,4-dimethyl-6-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-nitrophenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 167628409 |
| Molecular Formula | C22H29NO10 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-5-acetyloxy-3,4-dimethyl-6-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-nitrophenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2cc([N+](=O)[O-])ccc2C(=O)OC(C)(C)C)[C@H](OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C22H29NO10/c1-11-12(2)18(30-13(3)24)21(32-17(11)20(26)29-7)31-16-10-14(23(27)28)8-9-15(16)19(25)33-22(4,5)6/h8-12,17-18,21H,1-7H3/t11-,12-,17-,18+,21+/m0/s1 |
| InChIKey | JBNQAYUOYYEELQ-HXYVNAMPSA-N |
| XLogP | 3.03 |
| TPSA | 140.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|