C20H24N2O12 — CID 11225461
methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(methylamino)-4-nitrophenoxy]oxane-2-carboxylate (PubChem CID 11225461) has the molecular formula C20H24N2O12 and a molecular weight of 484.41 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(methylamino)-4-nitrophenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(methylamino)-4-nitrophenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11225461 |
| Molecular Formula | C20H24N2O12 |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(methylamino)-4-nitrophenoxy]oxane-2-carboxylate |
| SMILES | CNc1cc([N+](=O)[O-])ccc1O[C@@H]1O[C@H](C(=O)OC)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H24N2O12/c1-9(23)30-15-16(31-10(2)24)18(32-11(3)25)20(34-17(15)19(26)29-5)33-14-7-6-12(22(27)28)8-13(14)21-4/h6-8,15-18,20-21H,1-5H3/t15-,16+,17+,18-,20-/m1/s1 |
| InChIKey | YFFGXDSVCYOLBV-ZMIKWESLSA-N |
| XLogP | 0.71 |
| TPSA | 178.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|