C30H28N2O17 — CID 126760150
methyl 3,4,5-triacetyloxy-6-[2-nitro-4-[1-(4-nitrophenoxy)carbonyloxybut-3-ynyl]phenoxy]oxane-2-carboxylate (PubChem CID 126760150) has the molecular formula C30H28N2O17 and a molecular weight of 688.55 g/mol. Its IUPAC name is methyl 3,4,5-triacetyloxy-6-[2-nitro-4-[1-(4-nitrophenoxy)carbonyloxybut-3-ynyl]phenoxy]oxane-2-carboxylate.
| Compound Name | methyl 3,4,5-triacetyloxy-6-[2-nitro-4-[1-(4-nitrophenoxy)carbonyloxybut-3-ynyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 126760150 |
| Molecular Formula | C30H28N2O17 |
| Molecular Weight | 688.55 g/mol |
| Exact Mass | 688.14 |
| IUPAC Name | methyl 3,4,5-triacetyloxy-6-[2-nitro-4-[1-(4-nitrophenoxy)carbonyloxybut-3-ynyl]phenoxy]oxane-2-carboxylate |
| SMILES | C#CCC(OC(=O)Oc1ccc([N+](=O)[O-])cc1)c1ccc(OC2OC(C(=O)OC)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H28N2O17/c1-6-7-22(48-30(37)46-20-11-9-19(10-12-20)31(38)39)18-8-13-23(21(14-18)32(40)41)47-29-27(45-17(4)35)25(44-16(3)34)24(43-15(2)33)26(49-29)28(36)42-5/h1,8-14,22,24-27,29H,7H2,2-5H3 |
| InChIKey | JXWXFIFQCNJURG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 245.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|