C19H21NO8 — CID 121300807
[(3R,4R,5S)-4,5-diacetyloxy-6-(2-cyano-4-methylphenoxy)oxan-3-yl] acetate (PubChem CID 121300807) has the molecular formula C19H21NO8 and a molecular weight of 391.38 g/mol. Its IUPAC name is [(3R,4R,5S)-4,5-diacetyloxy-6-(2-cyano-4-methylphenoxy)oxan-3-yl] acetate.
| Compound Name | [(3R,4R,5S)-4,5-diacetyloxy-6-(2-cyano-4-methylphenoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 121300807 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [(3R,4R,5S)-4,5-diacetyloxy-6-(2-cyano-4-methylphenoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)C(Oc2ccc(C)cc2C#N)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H21NO8/c1-10-5-6-15(14(7-10)8-20)28-19-18(27-13(4)23)17(26-12(3)22)16(9-24-19)25-11(2)21/h5-7,16-19H,9H2,1-4H3/t16-,17-,18+,19?/m1/s1 |
| InChIKey | YKDCSCKMDZXJIX-KAKFPZCNSA-N |
| XLogP | 1.40 |
| TPSA | 121.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|