C11H11FN2O8 — CID 155887225
6-(2,4-dinitrophenoxy)-5-fluorooxane-3,4-diol (PubChem CID 155887225) has the molecular formula C11H11FN2O8 and a molecular weight of 318.21 g/mol. Its IUPAC name is 6-(2,4-dinitrophenoxy)-5-fluorooxane-3,4-diol.
| Compound Name | 6-(2,4-dinitrophenoxy)-5-fluorooxane-3,4-diol |
|---|---|
| PubChem CID | 155887225 |
| Molecular Formula | C11H11FN2O8 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 6-(2,4-dinitrophenoxy)-5-fluorooxane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(OC2OCC(O)C(O)C2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11FN2O8/c12-9-10(16)7(15)4-21-11(9)22-8-2-1-5(13(17)18)3-6(8)14(19)20/h1-3,7,9-11,15-16H,4H2 |
| InChIKey | FFZAEQIDAVDSET-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|