C14H14N2O5 — CID 125028748
(1R,2S,4S,5S,6R)-5-(2,4-dinitrophenoxy)tricyclo[4.2.0.02,4]octane (PubChem CID 125028748) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is (1R,2S,4S,5S,6R)-5-(2,4-dinitrophenoxy)tricyclo[4.2.0.02,4]octane.
| Compound Name | (1R,2S,4S,5S,6R)-5-(2,4-dinitrophenoxy)tricyclo[4.2.0.02,4]octane |
|---|---|
| PubChem CID | 125028748 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (1R,2S,4S,5S,6R)-5-(2,4-dinitrophenoxy)tricyclo[4.2.0.02,4]octane |
| SMILES | O=[N+]([O-])c1ccc(O[C@H]2[C@@H]3CC[C@@H]3[C@@H]3C[C@@H]32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H14N2O5/c17-15(18)7-1-4-13(12(5-7)16(19)20)21-14-9-3-2-8(9)10-6-11(10)14/h1,4-5,8-11,14H,2-3,6H2/t8-,9+,10-,11-,14-/m0/s1 |
| InChIKey | XOSFKAWJKZAYQM-KKSJPVRNSA-N |
| XLogP | 2.93 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|