C10H10N2O7S — CID 3713141
3-(2,4-dinitrophenoxy)thiolane 1,1-dioxide (PubChem CID 3713141) has the molecular formula C10H10N2O7S and a molecular weight of 302.26 g/mol. Its IUPAC name is 3-(2,4-dinitrophenoxy)thiolane 1,1-dioxide.
| Compound Name | 3-(2,4-dinitrophenoxy)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 3713141 |
| Molecular Formula | C10H10N2O7S |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3-(2,4-dinitrophenoxy)thiolane 1,1-dioxide |
| SMILES | O=[N+]([O-])c1ccc(OC2CCS(=O)(=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10N2O7S/c13-11(14)7-1-2-10(9(5-7)12(15)16)19-8-3-4-20(17,18)6-8/h1-2,5,8H,3-4,6H2 |
| InChIKey | UIMXNDCYXXUKEJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|