C6H3LiN2O7S — CID 175163574
lithium (2,4-dinitrophenyl) sulfite (PubChem CID 175163574) has the molecular formula C6H3LiN2O7S and a molecular weight of 254.10 g/mol. Its IUPAC name is lithium (2,4-dinitrophenyl) sulfite.
| Compound Name | lithium (2,4-dinitrophenyl) sulfite |
|---|---|
| PubChem CID | 175163574 |
| Molecular Formula | C6H3LiN2O7S |
| Molecular Weight | 254.10 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | lithium (2,4-dinitrophenyl) sulfite |
| SMILES | O=[N+]([O-])c1ccc(OS(=O)[O-])c([N+](=O)[O-])c1.[Li+] |
| InChI | InChI=1S/C6H4N2O7S.Li/c9-7(10)4-1-2-6(15-16(13)14)5(3-4)8(11)12;/h1-3H,(H,13,14);/q;+1/p-1 |
| InChIKey | NESHEOWQHQDILV-UHFFFAOYSA-M |
| XLogP | -2.32 |
| TPSA | 135.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.10 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|