About potassium (2-chloro-5-nitrophenyl) sulfite
potassium (2-chloro-5-nitrophenyl) sulfite (PubChem CID 175273368) has the molecular formula C6H3ClKNO5S
and a molecular weight of 275.71 g/mol. Its IUPAC name is potassium (2-chloro-5-nitrophenyl) sulfite.
Molecular Properties
| Compound Name | potassium (2-chloro-5-nitrophenyl) sulfite |
| PubChem CID | 175273368 |
| Molecular Formula | C6H3ClKNO5S |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 274.91 |
| IUPAC Name | potassium (2-chloro-5-nitrophenyl) sulfite |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(OS(=O)[O-])c1.[K+] |
| InChI | InChI=1S/C6H4ClNO5S.K/c7-5-2-1-4(8(9)10)3-6(5)13-14(11)12;/h1-3H,(H,11,12);/q;+1/p-1 |
| InChIKey | YFCJUXIZGMNXLL-UHFFFAOYSA-M |
| XLogP | -1.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze potassium (2-chloro-5-nitrophenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (2-chloro-5-nitrophenyl) sulfite?
The IUPAC name of potassium (2-chloro-5-nitrophenyl) sulfite (CID 175273368) is potassium (2-chloro-5-nitrophenyl) sulfite.
What is the SMILES notation for potassium (2-chloro-5-nitrophenyl) sulfite?
The canonical SMILES for potassium (2-chloro-5-nitrophenyl) sulfite is O=[N+]([O-])c1ccc(Cl)c(OS(=O)[O-])c1.[K+].
What is the InChIKey of potassium (2-chloro-5-nitrophenyl) sulfite?
The InChIKey is YFCJUXIZGMNXLL-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4ClNO5S.K/c7-5-2-1-4(8(9)10)3-6(5)13-14(11)12;/h1-3H,(H,11,12);/q;+1/p-1.
What are the key properties of potassium (2-chloro-5-nitrophenyl) sulfite?
potassium (2-chloro-5-nitrophenyl) sulfite has a molecular weight of 275.71 g/mol, XLogP of -1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (2-chloro-5-nitrophenyl) sulfite is sourced from PubChem (CID 175273368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).