C10H9ClF3NO3 — CID 115519762
1-chloro-4-nitro-2-(4,4,4-trifluorobutoxy)benzene (PubChem CID 115519762) has the molecular formula C10H9ClF3NO3 and a molecular weight of 283.63 g/mol. Its IUPAC name is 1-chloro-4-nitro-2-(4,4,4-trifluorobutoxy)benzene.
| Compound Name | 1-chloro-4-nitro-2-(4,4,4-trifluorobutoxy)benzene |
|---|---|
| PubChem CID | 115519762 |
| Molecular Formula | C10H9ClF3NO3 |
| Molecular Weight | 283.63 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 1-chloro-4-nitro-2-(4,4,4-trifluorobutoxy)benzene |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(OCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H9ClF3NO3/c11-8-3-2-7(15(16)17)6-9(8)18-5-1-4-10(12,13)14/h2-3,6H,1,4-5H2 |
| InChIKey | GTEPMEDTZFOWGI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|