C10H10F3NO4 — CID 64564855
[5-nitro-2-(3,3,3-trifluoropropoxy)phenyl]methanol (PubChem CID 64564855) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is [5-nitro-2-(3,3,3-trifluoropropoxy)phenyl]methanol.
| Compound Name | [5-nitro-2-(3,3,3-trifluoropropoxy)phenyl]methanol |
|---|---|
| PubChem CID | 64564855 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | [5-nitro-2-(3,3,3-trifluoropropoxy)phenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(OCCC(F)(F)F)c(CO)c1 |
| InChI | InChI=1S/C10H10F3NO4/c11-10(12,13)3-4-18-9-2-1-8(14(16)17)5-7(9)6-15/h1-2,5,15H,3-4,6H2 |
| InChIKey | BUDJLTVECODQAX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|