C10H7ClF3NO3 — CID 153206867
1-(2-chloro-5-nitrophenyl)-4,4,4-trifluorobutan-1-one (PubChem CID 153206867) has the molecular formula C10H7ClF3NO3 and a molecular weight of 281.62 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 153206867 |
| Molecular Formula | C10H7ClF3NO3 |
| Molecular Weight | 281.62 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C10H7ClF3NO3/c11-8-2-1-6(15(17)18)5-7(8)9(16)3-4-10(12,13)14/h1-2,5H,3-4H2 |
| InChIKey | HAGZLJZJTZRZCB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|