C15H9ClF4N2O3 — CID 122618117
2-chloro-N-(4-fluorophenyl)-5-nitro-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 122618117) has the molecular formula C15H9ClF4N2O3 and a molecular weight of 376.69 g/mol. Its IUPAC name is 2-chloro-N-(4-fluorophenyl)-5-nitro-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-chloro-N-(4-fluorophenyl)-5-nitro-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 122618117 |
| Molecular Formula | C15H9ClF4N2O3 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-chloro-N-(4-fluorophenyl)-5-nitro-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1Cl)N(CC(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H9ClF4N2O3/c16-13-6-5-11(22(24)25)7-12(13)14(23)21(8-15(18,19)20)10-3-1-9(17)2-4-10/h1-7H,8H2 |
| InChIKey | MJPXMKHQESKBHL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|