C12H14ClF3N2O2 — CID 116534376
2-chloro-5-nitro-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 116534376) has the molecular formula C12H14ClF3N2O2 and a molecular weight of 310.70 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 2-chloro-5-nitro-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 116534376 |
| Molecular Formula | C12H14ClF3N2O2 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-chloro-5-nitro-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | CC(CCCC(F)(F)F)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O2/c1-8(3-2-6-12(14,15)16)17-11-7-9(18(19)20)4-5-10(11)13/h4-5,7-8,17H,2-3,6H2,1H3 |
| InChIKey | XBCVWLXHYLYOAY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|