C13H19ClN2O2 — CID 114270475
2-chloro-5-nitro-N-(2,3,3-trimethylbutyl)aniline (PubChem CID 114270475) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-(2,3,3-trimethylbutyl)aniline.
| Compound Name | 2-chloro-5-nitro-N-(2,3,3-trimethylbutyl)aniline |
|---|---|
| PubChem CID | 114270475 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-chloro-5-nitro-N-(2,3,3-trimethylbutyl)aniline |
| SMILES | CC(CNc1cc([N+](=O)[O-])ccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C13H19ClN2O2/c1-9(13(2,3)4)8-15-12-7-10(16(17)18)5-6-11(12)14/h5-7,9,15H,8H2,1-4H3 |
| InChIKey | ZQOSAWPJMPTPQF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|