C14H20N4O2 — CID 83144546
6-nitro-N-(2,3,3-trimethylbutyl)-1H-benzimidazol-2-amine (PubChem CID 83144546) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-nitro-N-(2,3,3-trimethylbutyl)-1H-benzimidazol-2-amine.
| Compound Name | 6-nitro-N-(2,3,3-trimethylbutyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 83144546 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 6-nitro-N-(2,3,3-trimethylbutyl)-1H-benzimidazol-2-amine |
| SMILES | CC(CNc1nc2ccc([N+](=O)[O-])cc2[nH]1)C(C)(C)C |
| InChI | InChI=1S/C14H20N4O2/c1-9(14(2,3)4)8-15-13-16-11-6-5-10(18(19)20)7-12(11)17-13/h5-7,9H,8H2,1-4H3,(H2,15,16,17) |
| InChIKey | LORYDFIHUPTQJP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|