C14H20N2O4 — CID 83144511
4-nitro-2-(2,3,3-trimethylbutylamino)benzoic acid (PubChem CID 83144511) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4-nitro-2-(2,3,3-trimethylbutylamino)benzoic acid.
| Compound Name | 4-nitro-2-(2,3,3-trimethylbutylamino)benzoic acid |
|---|---|
| PubChem CID | 83144511 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-nitro-2-(2,3,3-trimethylbutylamino)benzoic acid |
| SMILES | CC(CNc1cc([N+](=O)[O-])ccc1C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H20N2O4/c1-9(14(2,3)4)8-15-12-7-10(16(19)20)5-6-11(12)13(17)18/h5-7,9,15H,8H2,1-4H3,(H,17,18) |
| InChIKey | ZFKFABZSZYPUFE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|