2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid

C13H18N2O4 — CID 64597325

IUPAC2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid
SMILESCC(C)C(C)CNc1ccc([N+](=O)[O-])cc1C(=O)O
InChIInChI=1S/C13H18N2O4/c1-8(2)9(3)7-14-12-5-4-10(15(18)19)6-11(12)13(16)17/h4-6,8-9,14H,7H2,1-3H3,(H,16,17)
InChIKeyCRKFXTZHJOADDO-UHFFFAOYSA-N
MW266.30 g/mol
LogP3.00
Rot. Bonds6

About 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid

2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid (PubChem CID 64597325) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid.

Molecular Properties

Compound Name2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid
PubChem CID64597325
Molecular FormulaC13H18N2O4
Molecular Weight266.30 g/mol
Exact Mass266.13
IUPAC Name2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid
SMILESCC(C)C(C)CNc1ccc([N+](=O)[O-])cc1C(=O)O
InChIInChI=1S/C13H18N2O4/c1-8(2)9(3)7-14-12-5-4-10(15(18)19)6-11(12)13(16)17/h4-6,8-9,14H,7H2,1-3H3,(H,16,17)
InChIKeyCRKFXTZHJOADDO-UHFFFAOYSA-N
XLogP3.00
TPSA92.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.30
LogP ≤ 53.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid?
The IUPAC name of 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid (CID 64597325) is 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid.
What is the SMILES notation for 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid?
The canonical SMILES for 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid is CC(C)C(C)CNc1ccc([N+](=O)[O-])cc1C(=O)O.
What is the InChIKey of 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid?
The InChIKey is CRKFXTZHJOADDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-8(2)9(3)7-14-12-5-4-10(15(18)19)6-11(12)13(16)17/h4-6,8-9,14H,7H2,1-3H3,(H,16,17).
What are the key properties of 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid?
2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid has a molecular weight of 266.30 g/mol, XLogP of 3.00, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylbutylamino)-5-nitrobenzoic acid is sourced from PubChem (CID 64597325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).