C12H12N2O4 — CID 106222353
5-nitro-2-(pent-4-ynylamino)benzoic acid (PubChem CID 106222353) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 5-nitro-2-(pent-4-ynylamino)benzoic acid.
| Compound Name | 5-nitro-2-(pent-4-ynylamino)benzoic acid |
|---|---|
| PubChem CID | 106222353 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-nitro-2-(pent-4-ynylamino)benzoic acid |
| SMILES | C#CCCCNc1ccc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C12H12N2O4/c1-2-3-4-7-13-11-6-5-9(14(17)18)8-10(11)12(15)16/h1,5-6,8,13H,3-4,7H2,(H,15,16) |
| InChIKey | UZTVSZXSCOPVIK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|