C11H14N2O5S — CID 113487682
2-(3-methylsulfinylpropylamino)-5-nitrobenzoic acid (PubChem CID 113487682) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(3-methylsulfinylpropylamino)-5-nitrobenzoic acid.
| Compound Name | 2-(3-methylsulfinylpropylamino)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 113487682 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(3-methylsulfinylpropylamino)-5-nitrobenzoic acid |
| SMILES | CS(=O)CCCNc1ccc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C11H14N2O5S/c1-19(18)6-2-5-12-10-4-3-8(13(16)17)7-9(10)11(14)15/h3-4,7,12H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | AMZQXDJTPLNASH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|