C10H13N3O5S — CID 114194524
5-(3-methylsulfinylpropylamino)-2-nitropyridine-4-carboxylic acid (PubChem CID 114194524) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is 5-(3-methylsulfinylpropylamino)-2-nitropyridine-4-carboxylic acid.
| Compound Name | 5-(3-methylsulfinylpropylamino)-2-nitropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114194524 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-(3-methylsulfinylpropylamino)-2-nitropyridine-4-carboxylic acid |
| SMILES | CS(=O)CCCNc1cnc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C10H13N3O5S/c1-19(18)4-2-3-11-8-6-12-9(13(16)17)5-7(8)10(14)15/h5-6,11H,2-4H2,1H3,(H,14,15) |
| InChIKey | UHSRMQCZGCYNBC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|