C11H13N3O4 — CID 114194514
2-nitro-5-[[(E)-pent-3-enyl]amino]pyridine-4-carboxylic acid (PubChem CID 114194514) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-nitro-5-[[(E)-pent-3-enyl]amino]pyridine-4-carboxylic acid.
| Compound Name | 2-nitro-5-[[(E)-pent-3-enyl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114194514 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-nitro-5-[[(E)-pent-3-enyl]amino]pyridine-4-carboxylic acid |
| SMILES | C/C=C/CCNc1cnc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C11H13N3O4/c1-2-3-4-5-12-9-7-13-10(14(17)18)6-8(9)11(15)16/h2-3,6-7,12H,4-5H2,1H3,(H,15,16)/b3-2+ |
| InChIKey | XLZKRLYZNKDTCC-NSCUHMNNSA-N |
| XLogP | 2.07 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|