C8H10N4O6S — CID 114194432
2-nitro-5-(2-sulfamoylethylamino)pyridine-4-carboxylic acid (PubChem CID 114194432) has the molecular formula C8H10N4O6S and a molecular weight of 290.26 g/mol. Its IUPAC name is 2-nitro-5-(2-sulfamoylethylamino)pyridine-4-carboxylic acid.
| Compound Name | 2-nitro-5-(2-sulfamoylethylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114194432 |
| Molecular Formula | C8H10N4O6S |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-nitro-5-(2-sulfamoylethylamino)pyridine-4-carboxylic acid |
| SMILES | NS(=O)(=O)CCNc1cnc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C8H10N4O6S/c9-19(17,18)2-1-10-6-4-11-7(12(15)16)3-5(6)8(13)14/h3-4,10H,1-2H2,(H,13,14)(H2,9,17,18) |
| InChIKey | YYSJLUPUQGCWRH-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 165.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|