C12H16N2O5S — CID 106161932
2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-4-nitrobenzoic acid (PubChem CID 106161932) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-4-nitrobenzoic acid.
| Compound Name | 2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 106161932 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-4-nitrobenzoic acid |
| SMILES | CSC(CO)C(C)Nc1cc([N+](=O)[O-])ccc1C(=O)O |
| InChI | InChI=1S/C12H16N2O5S/c1-7(11(6-15)20-2)13-10-5-8(14(18)19)3-4-9(10)12(16)17/h3-5,7,11,13,15H,6H2,1-2H3,(H,16,17) |
| InChIKey | ZYUDSZPUVBVSNL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|