C13H16ClNO4 — CID 116525449
5-[(2-chloro-5-nitrophenoxy)methyl]-2,2-dimethyloxolane (PubChem CID 116525449) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is 5-[(2-chloro-5-nitrophenoxy)methyl]-2,2-dimethyloxolane.
| Compound Name | 5-[(2-chloro-5-nitrophenoxy)methyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116525449 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 5-[(2-chloro-5-nitrophenoxy)methyl]-2,2-dimethyloxolane |
| SMILES | CC1(C)CCC(COc2cc([N+](=O)[O-])ccc2Cl)O1 |
| InChI | InChI=1S/C13H16ClNO4/c1-13(2)6-5-10(19-13)8-18-12-7-9(15(16)17)3-4-11(12)14/h3-4,7,10H,5-6,8H2,1-2H3 |
| InChIKey | ACDUUUYVKBKRJZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|