C13H17IN2O4 — CID 114775752
6-[(2-iodo-4-nitrophenoxy)methyl]-2,2-dimethylmorpholine (PubChem CID 114775752) has the molecular formula C13H17IN2O4 and a molecular weight of 392.19 g/mol. Its IUPAC name is 6-[(2-iodo-4-nitrophenoxy)methyl]-2,2-dimethylmorpholine.
| Compound Name | 6-[(2-iodo-4-nitrophenoxy)methyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114775752 |
| Molecular Formula | C13H17IN2O4 |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 6-[(2-iodo-4-nitrophenoxy)methyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CNCC(COc2ccc([N+](=O)[O-])cc2I)O1 |
| InChI | InChI=1S/C13H17IN2O4/c1-13(2)8-15-6-10(20-13)7-19-12-4-3-9(16(17)18)5-11(12)14/h3-5,10,15H,6-8H2,1-2H3 |
| InChIKey | YEGBMVWKIMAZGH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|