About 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile
6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile (PubChem CID 103473350) has the molecular formula C13H16N4O4
and a molecular weight of 292.30 g/mol. Its IUPAC name is 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile |
| PubChem CID | 103473350 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile |
| SMILES | CC1(C)CNCC(COc2ncc(C#N)cc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C13H16N4O4/c1-13(2)8-15-6-10(21-13)7-20-12-11(17(18)19)3-9(4-14)5-16-12/h3,5,10,15H,6-8H2,1-2H3 |
| InChIKey | GRRFCWOPAKTQEP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile?
The IUPAC name of 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile (CID 103473350) is 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile.
What is the SMILES notation for 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile?
The canonical SMILES for 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile is CC1(C)CNCC(COc2ncc(C#N)cc2[N+](=O)[O-])O1.
What is the InChIKey of 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile?
The InChIKey is GRRFCWOPAKTQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O4/c1-13(2)8-15-6-10(21-13)7-20-12-11(17(18)19)3-9(4-14)5-16-12/h3,5,10,15H,6-8H2,1-2H3.
What are the key properties of 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile?
6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile has a molecular weight of 292.30 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(6,6-dimethylmorpholin-2-yl)methoxy]-5-nitropyridine-3-carbonitrile is sourced from PubChem (CID 103473350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).