C13H16Cl2N2O4 — CID 106891998
6-[(2,6-dichloro-4-nitrophenoxy)methyl]-2,2-dimethylmorpholine (PubChem CID 106891998) has the molecular formula C13H16Cl2N2O4 and a molecular weight of 335.19 g/mol. Its IUPAC name is 6-[(2,6-dichloro-4-nitrophenoxy)methyl]-2,2-dimethylmorpholine.
| Compound Name | 6-[(2,6-dichloro-4-nitrophenoxy)methyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 106891998 |
| Molecular Formula | C13H16Cl2N2O4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 6-[(2,6-dichloro-4-nitrophenoxy)methyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CNCC(COc2c(Cl)cc([N+](=O)[O-])cc2Cl)O1 |
| InChI | InChI=1S/C13H16Cl2N2O4/c1-13(2)7-16-5-9(21-13)6-20-12-10(14)3-8(17(18)19)4-11(12)15/h3-4,9,16H,5-7H2,1-2H3 |
| InChIKey | INHHNRFSCWGZJD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|