C14H19ClN2O3 — CID 114775879
5-chloro-2-[(6,6-dimethylmorpholin-2-yl)methoxy]benzamide (PubChem CID 114775879) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-chloro-2-[(6,6-dimethylmorpholin-2-yl)methoxy]benzamide.
| Compound Name | 5-chloro-2-[(6,6-dimethylmorpholin-2-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 114775879 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-chloro-2-[(6,6-dimethylmorpholin-2-yl)methoxy]benzamide |
| SMILES | CC1(C)CNCC(COc2ccc(Cl)cc2C(N)=O)O1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-14(2)8-17-6-10(20-14)7-19-12-4-3-9(15)5-11(12)13(16)18/h3-5,10,17H,6-8H2,1-2H3,(H2,16,18) |
| InChIKey | OKSOZKMUZRCPKV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |