C15H21ClN2O3 — CID 114775297
N-(3-chlorophenyl)-2-[(6,6-dimethylmorpholin-2-yl)methoxy]acetamide (PubChem CID 114775297) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(6,6-dimethylmorpholin-2-yl)methoxy]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(6,6-dimethylmorpholin-2-yl)methoxy]acetamide |
|---|---|
| PubChem CID | 114775297 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(6,6-dimethylmorpholin-2-yl)methoxy]acetamide |
| SMILES | CC1(C)CNCC(COCC(=O)Nc2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-15(2)10-17-7-13(21-15)8-20-9-14(19)18-12-5-3-4-11(16)6-12/h3-6,13,17H,7-10H2,1-2H3,(H,18,19) |
| InChIKey | MWAKWSDEOUHEQE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |